C23H30F2O — CID 90161378
1-[4-(4-ethenylcyclohexyl)cyclohexyl]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene (PubChem CID 90161378) has the molecular formula C23H30F2O and a molecular weight of 360.49 g/mol. Its IUPAC name is 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene.
| Compound Name | 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene |
|---|---|
| PubChem CID | 90161378 |
| Molecular Formula | C23H30F2O |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene |
| SMILES | C=CC1CCC(C2CCC(c3ccc(O/C=C/C)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C23H30F2O/c1-3-15-26-21-14-13-20(22(24)23(21)25)19-11-9-18(10-12-19)17-7-5-16(4-2)6-8-17/h3-4,13-19H,2,5-12H2,1H3/b15-3+ |
| InChIKey | JKYDJBYDNZNNQQ-CRKCGEKBSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|