C30H36F4O — CID 90161636
1-[2,3-difluoro-4-[(E)-prop-1-enoxy]phenyl]-2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 90161636) has the molecular formula C30H36F4O and a molecular weight of 488.61 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[(E)-prop-1-enoxy]phenyl]-2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1-[2,3-difluoro-4-[(E)-prop-1-enoxy]phenyl]-2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 90161636 |
| Molecular Formula | C30H36F4O |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 1-[2,3-difluoro-4-[(E)-prop-1-enoxy]phenyl]-2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | C/C=C/Oc1ccc(-c2ccc(C3CCC(C4CCC(CCC)CC4)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H36F4O/c1-3-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)23-14-15-24(28(32)27(23)31)25-16-17-26(35-18-4-2)30(34)29(25)33/h4,14-22H,3,5-13H2,1-2H3/b18-4+ |
| InChIKey | JNCXHNCRGQKZTB-JJPRUIFNSA-N |
| XLogP | 9.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|