C19H26F2O — CID 123313096
1-but-1-enoxy-2,3-difluoro-4-(4-propylcyclohexyl)benzene (PubChem CID 123313096) has the molecular formula C19H26F2O and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-but-1-enoxy-2,3-difluoro-4-(4-propylcyclohexyl)benzene.
| Compound Name | 1-but-1-enoxy-2,3-difluoro-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 123313096 |
| Molecular Formula | C19H26F2O |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1-but-1-enoxy-2,3-difluoro-4-(4-propylcyclohexyl)benzene |
| SMILES | CCC=COc1ccc(C2CCC(CCC)CC2)c(F)c1F |
| InChI | InChI=1S/C19H26F2O/c1-3-5-13-22-17-12-11-16(18(20)19(17)21)15-9-7-14(6-4-2)8-10-15/h5,11-15H,3-4,6-10H2,1-2H3 |
| InChIKey | PCJHOBMQUAPEKE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|