C36H46F4O3 — CID 58453603
[4-[4-(4-butoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-(2,3-difluoro-4-methylphenyl)cyclohexane-1-carboxylate (PubChem CID 58453603) has the molecular formula C36H46F4O3 and a molecular weight of 602.75 g/mol. Its IUPAC name is [4-[4-(4-butoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-(2,3-difluoro-4-methylphenyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[4-(4-butoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-(2,3-difluoro-4-methylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58453603 |
| Molecular Formula | C36H46F4O3 |
| Molecular Weight | 602.75 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | [4-[4-(4-butoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-(2,3-difluoro-4-methylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCOc1ccc(C2CCC(C3CCC(OC(=O)C4CCC(c5ccc(C)c(F)c5F)CC4)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C36H46F4O3/c1-3-4-21-42-31-20-19-30(34(39)35(31)40)25-8-6-23(7-9-25)24-14-16-28(17-15-24)43-36(41)27-12-10-26(11-13-27)29-18-5-22(2)32(37)33(29)38/h5,18-20,23-28H,3-4,6-17,21H2,1-2H3 |
| InChIKey | KOGAHCIDLHKHGD-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.75 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|