C30H42F2O3 — CID 71001322
[4-(2,3-difluoro-4-hexoxyphenyl)cyclohexyl] 4-propyl-1,2,3,3a,6,6a-hexahydropentalene-1-carboxylate (PubChem CID 71001322) has the molecular formula C30H42F2O3 and a molecular weight of 488.66 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-hexoxyphenyl)cyclohexyl] 4-propyl-1,2,3,3a,6,6a-hexahydropentalene-1-carboxylate.
| Compound Name | [4-(2,3-difluoro-4-hexoxyphenyl)cyclohexyl] 4-propyl-1,2,3,3a,6,6a-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 71001322 |
| Molecular Formula | C30H42F2O3 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | [4-(2,3-difluoro-4-hexoxyphenyl)cyclohexyl] 4-propyl-1,2,3,3a,6,6a-hexahydropentalene-1-carboxylate |
| SMILES | CCCCCCOc1ccc(C2CCC(OC(=O)C3CCC4C(CCC)=CCC34)CC2)c(F)c1F |
| InChI | InChI=1S/C30H42F2O3/c1-3-5-6-7-19-34-27-18-17-24(28(31)29(27)32)21-9-12-22(13-10-21)35-30(33)26-16-15-23-20(8-4-2)11-14-25(23)26/h11,17-18,21-23,25-26H,3-10,12-16,19H2,1-2H3 |
| InChIKey | JXUCAMYLFQQMMX-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|