C33H36F6O2 — CID 122643372
1-[2-(2,3-difluoro-4-pentoxyphenyl)ethyl]-4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzene (PubChem CID 122643372) has the molecular formula C33H36F6O2 and a molecular weight of 578.64 g/mol. Its IUPAC name is 1-[2-(2,3-difluoro-4-pentoxyphenyl)ethyl]-4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzene.
| Compound Name | 1-[2-(2,3-difluoro-4-pentoxyphenyl)ethyl]-4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 122643372 |
| Molecular Formula | C33H36F6O2 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 1-[2-(2,3-difluoro-4-pentoxyphenyl)ethyl]-4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzene |
| SMILES | CCCCCOc1ccc(CCc2ccc(C3CCC(c4ccc(OCC)c(F)c4F)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C33H36F6O2/c1-3-5-6-19-41-27-17-14-23(29(35)32(27)38)12-11-22-13-15-24(30(36)28(22)34)20-7-9-21(10-8-20)25-16-18-26(40-4-2)33(39)31(25)37/h13-18,20-21H,3-12,19H2,1-2H3 |
| InChIKey | ODPKAIRGJPIGQB-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|