C28H25F6IO — CID 122643391
1-[2-(2,3-difluoro-4-iodophenyl)ethyl]-4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzene (PubChem CID 122643391) has the molecular formula C28H25F6IO and a molecular weight of 618.40 g/mol. Its IUPAC name is 1-[2-(2,3-difluoro-4-iodophenyl)ethyl]-4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzene.
| Compound Name | 1-[2-(2,3-difluoro-4-iodophenyl)ethyl]-4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 122643391 |
| Molecular Formula | C28H25F6IO |
| Molecular Weight | 618.40 g/mol |
| Exact Mass | 618.09 |
| IUPAC Name | 1-[2-(2,3-difluoro-4-iodophenyl)ethyl]-4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzene |
| SMILES | CCOc1ccc(C2CCC(c3ccc(CCc4ccc(I)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C28H25F6IO/c1-2-36-22-14-12-20(26(32)28(22)34)16-5-3-15(4-6-16)19-11-9-17(23(29)25(19)31)7-8-18-10-13-21(35)27(33)24(18)30/h9-16H,2-8H2,1H3 |
| InChIKey | BZMKXTTUHXVHIE-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.40 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|