C28H32F4O — CID 126501946
1-ethoxy-4-[4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexylidene]cyclohexyl]-2,3-difluorobenzene (PubChem CID 126501946) has the molecular formula C28H32F4O and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-ethoxy-4-[4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexylidene]cyclohexyl]-2,3-difluorobenzene.
| Compound Name | 1-ethoxy-4-[4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexylidene]cyclohexyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 126501946 |
| Molecular Formula | C28H32F4O |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 1-ethoxy-4-[4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexylidene]cyclohexyl]-2,3-difluorobenzene |
| SMILES | CCOc1ccc(C2CCC(=C3CCC(c4ccc(CC)c(F)c4F)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C28H32F4O/c1-3-17-13-14-22(26(30)25(17)29)20-9-5-18(6-10-20)19-7-11-21(12-8-19)23-15-16-24(33-4-2)28(32)27(23)31/h13-16,20-21H,3-12H2,1-2H3/b19-18- |
| InChIKey | YEBNRUVXPPFQGC-HNENSFHCSA-N |
| XLogP | 8.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|