C25H36F2O2 — CID 58021257
5-but-3-enyl-2-[4-(4-butoxy-2,3-difluorophenyl)cyclohexyl]oxane (PubChem CID 58021257) has the molecular formula C25H36F2O2 and a molecular weight of 406.56 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-(4-butoxy-2,3-difluorophenyl)cyclohexyl]oxane.
| Compound Name | 5-but-3-enyl-2-[4-(4-butoxy-2,3-difluorophenyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 58021257 |
| Molecular Formula | C25H36F2O2 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 5-but-3-enyl-2-[4-(4-butoxy-2,3-difluorophenyl)cyclohexyl]oxane |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(OCCCC)c(F)c3F)CC2)OC1 |
| InChI | InChI=1S/C25H36F2O2/c1-3-5-7-18-8-14-22(29-17-18)20-11-9-19(10-12-20)21-13-15-23(25(27)24(21)26)28-16-6-4-2/h3,13,15,18-20,22H,1,4-12,14,16-17H2,2H3 |
| InChIKey | OROBZYGXLTXICO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|