C48H62O7 — CID 146668073
3-[4-[4-[4-[2-[2-(methoxymethyl)prop-2-enoyloxy]ethoxy]-3-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]phenyl]phenyl]propyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 146668073) has the molecular formula C48H62O7 and a molecular weight of 751.02 g/mol. Its IUPAC name is 3-[4-[4-[4-[2-[2-(methoxymethyl)prop-2-enoyloxy]ethoxy]-3-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]phenyl]phenyl]propyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 3-[4-[4-[4-[2-[2-(methoxymethyl)prop-2-enoyloxy]ethoxy]-3-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]phenyl]phenyl]propyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668073 |
| Molecular Formula | C48H62O7 |
| Molecular Weight | 751.02 g/mol |
| Exact Mass | 750.45 |
| IUPAC Name | 3-[4-[4-[4-[2-[2-(methoxymethyl)prop-2-enoyloxy]ethoxy]-3-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]phenyl]phenyl]propyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCCCc1ccc(-c2ccc(-c3ccc(OCCOC(=O)C(=C)COC)c(C4CCC(C5CCC(CCC)CC5)CC4)c3)cc2)cc1 |
| InChI | InChI=1S/C48H62O7/c1-6-8-36-10-14-38(15-11-36)41-22-24-43(25-23-41)45-31-44(26-27-46(45)53-29-30-55-48(50)35(3)33-52-5)42-20-18-40(19-21-42)39-16-12-37(13-17-39)9-7-28-54-47(49)34(2)32-51-4/h12-13,16-21,26-27,31,36,38,41,43H,2-3,6-11,14-15,22-25,28-30,32-33H2,1,4-5H3 |
| InChIKey | YEDDQLNNYNANRG-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.02 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|