C42H52O6 — CID 146668143
4-[4-[4-[4-(2-methylprop-2-enoyloxy)-2-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]butyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 146668143) has the molecular formula C42H52O6 and a molecular weight of 652.87 g/mol. Its IUPAC name is 4-[4-[4-[4-(2-methylprop-2-enoyloxy)-2-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]butyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 4-[4-[4-[4-(2-methylprop-2-enoyloxy)-2-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]butyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668143 |
| Molecular Formula | C42H52O6 |
| Molecular Weight | 652.87 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | 4-[4-[4-[4-(2-methylprop-2-enoyloxy)-2-(4-pentylcyclohexyl)phenyl]phenyl]phenoxy]butyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OCCCCOC(=O)C(=C)COC)cc3)cc2)c(C2CCC(CCCCC)CC2)c1 |
| InChI | InChI=1S/C42H52O6/c1-6-7-8-11-32-12-14-36(15-13-32)40-28-38(48-41(43)30(2)3)24-25-39(40)35-18-16-33(17-19-35)34-20-22-37(23-21-34)46-26-9-10-27-47-42(44)31(4)29-45-5/h16-25,28,32,36H,2,4,6-15,26-27,29H2,1,3,5H3 |
| InChIKey | YCNBRSUPDNBNHU-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.87 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|