C40H42N2O5 — CID 146668965
[4-[4-[4-(2-methylprop-2-enoyloxy)-2-[5-(4-propylcyclohexyl)pyrimidin-2-yl]phenyl]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 146668965) has the molecular formula C40H42N2O5 and a molecular weight of 630.78 g/mol. Its IUPAC name is [4-[4-[4-(2-methylprop-2-enoyloxy)-2-[5-(4-propylcyclohexyl)pyrimidin-2-yl]phenyl]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [4-[4-[4-(2-methylprop-2-enoyloxy)-2-[5-(4-propylcyclohexyl)pyrimidin-2-yl]phenyl]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668965 |
| Molecular Formula | C40H42N2O5 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | [4-[4-[4-(2-methylprop-2-enoyloxy)-2-[5-(4-propylcyclohexyl)pyrimidin-2-yl]phenyl]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)COC)cc3)cc2)c(-c2ncc(C3CCC(CCC)CC3)cn2)c1 |
| InChI | InChI=1S/C40H42N2O5/c1-6-7-28-8-10-31(11-9-28)33-23-41-38(42-24-33)37-22-35(47-39(43)26(2)3)20-21-36(37)32-14-12-29(13-15-32)30-16-18-34(19-17-30)46-40(44)27(4)25-45-5/h12-24,28,31H,2,4,6-11,25H2,1,3,5H3 |
| InChIKey | YNWKWTRSWSICFP-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|