C44H50O9 — CID 146668979
2-[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenyl]-3-[4-(4-prop-2-enoyloxycyclohexyl)cyclohexyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 146668979) has the molecular formula C44H50O9 and a molecular weight of 722.87 g/mol. Its IUPAC name is 2-[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenyl]-3-[4-(4-prop-2-enoyloxycyclohexyl)cyclohexyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenyl]-3-[4-(4-prop-2-enoyloxycyclohexyl)cyclohexyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668979 |
| Molecular Formula | C44H50O9 |
| Molecular Weight | 722.87 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | 2-[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenyl]-3-[4-(4-prop-2-enoyloxycyclohexyl)cyclohexyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(C2CCC(c3cc(OCCOC(=O)C(=C)CO)ccc3-c3ccc(-c4ccc(OC(=O)C(=C)COC)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C44H50O9/c1-5-42(46)52-37-18-14-33(15-19-37)32-8-12-36(13-9-32)41-26-39(50-24-25-51-43(47)29(2)27-45)22-23-40(41)35-10-6-31(7-11-35)34-16-20-38(21-17-34)53-44(48)30(3)28-49-4/h5-7,10-11,16-17,20-23,26,32-33,36-37,45H,1-3,8-9,12-15,18-19,24-25,27-28H2,4H3 |
| InChIKey | FUSFHKKJRWXOCL-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.87 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|