C38H44O6 — CID 146668916
3-[3-(4-butoxycyclohexyl)-4-[4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl]propyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 146668916) has the molecular formula C38H44O6 and a molecular weight of 596.76 g/mol. Its IUPAC name is 3-[3-(4-butoxycyclohexyl)-4-[4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl]propyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 3-[3-(4-butoxycyclohexyl)-4-[4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl]propyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668916 |
| Molecular Formula | C38H44O6 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 3-[3-(4-butoxycyclohexyl)-4-[4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl]propyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(-c3ccc(CCCOC(=O)C(=C)CO)cc3C3CCC(OCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C38H44O6/c1-4-6-23-42-33-18-16-32(17-19-33)36-25-28(8-7-24-43-38(41)27(3)26-39)9-22-35(36)31-12-10-29(11-13-31)30-14-20-34(21-15-30)44-37(40)5-2/h5,9-15,20-22,25,32-33,39H,2-4,6-8,16-19,23-24,26H2,1H3 |
| InChIKey | APLFFAWKNYCNAX-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|