C42H48O11 — CID 146668868
[4-[2,5-bis[4-[2-[2-(methoxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl]cyclohexyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 146668868) has the molecular formula C42H48O11 and a molecular weight of 728.83 g/mol. Its IUPAC name is [4-[2,5-bis[4-[2-[2-(methoxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl]cyclohexyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[2,5-bis[4-[2-[2-(methoxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl]cyclohexyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668868 |
| Molecular Formula | C42H48O11 |
| Molecular Weight | 728.83 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | [4-[2,5-bis[4-[2-[2-(methoxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl]cyclohexyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(OCCOC(=O)C(=C)COC)cc3)c(C3CCC(OC(=O)C(=C)CO)CC3)c2)cc1 |
| InChI | InChI=1S/C42H48O11/c1-28(25-43)42(46)53-37-17-10-33(11-18-37)39-24-34(31-6-13-35(14-7-31)49-20-22-51-40(44)29(2)26-47-4)12-19-38(39)32-8-15-36(16-9-32)50-21-23-52-41(45)30(3)27-48-5/h6-9,12-16,19,24,33,37,43H,1-3,10-11,17-18,20-23,25-27H2,4-5H3 |
| InChIKey | IUUDIZWTDADLQP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.83 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|