C24H25FO7 — CID 155139350
2-[3-fluoro-4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 155139350) has the molecular formula C24H25FO7 and a molecular weight of 444.46 g/mol. Its IUPAC name is 2-[3-fluoro-4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 2-[3-fluoro-4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155139350 |
| Molecular Formula | C24H25FO7 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[3-fluoro-4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]phenoxy]ethyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCCOc1ccc(-c2ccc(OC(=O)C(=C)COC)cc2)c(F)c1 |
| InChI | InChI=1S/C24H25FO7/c1-16(14-28-3)23(26)31-12-11-30-20-9-10-21(22(25)13-20)18-5-7-19(8-6-18)32-24(27)17(2)15-29-4/h5-10,13H,1-2,11-12,14-15H2,3-4H3 |
| InChIKey | VLMYWNSOQBGNNN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|