C40H52O8 — CID 146668869
[2-[4-[4-[2-(hydroxymethyl)prop-2-enoyloxy]cyclohexyl]cyclohexyl]-4-[4-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl] 3-methoxy-2-methylpropanoate (PubChem CID 146668869) has the molecular formula C40H52O8 and a molecular weight of 660.85 g/mol. Its IUPAC name is [2-[4-[4-[2-(hydroxymethyl)prop-2-enoyloxy]cyclohexyl]cyclohexyl]-4-[4-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl] 3-methoxy-2-methylpropanoate.
| Compound Name | [2-[4-[4-[2-(hydroxymethyl)prop-2-enoyloxy]cyclohexyl]cyclohexyl]-4-[4-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl] 3-methoxy-2-methylpropanoate |
|---|---|
| PubChem CID | 146668869 |
| Molecular Formula | C40H52O8 |
| Molecular Weight | 660.85 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | [2-[4-[4-[2-(hydroxymethyl)prop-2-enoyloxy]cyclohexyl]cyclohexyl]-4-[4-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenyl] 3-methoxy-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc(-c2ccc(OC(=O)C(C)COC)c(C3CCC(C4CCC(OC(=O)C(=C)CO)CC4)CC3)c2)cc1 |
| InChI | InChI=1S/C40H52O8/c1-26(2)38(42)46-22-6-7-29-8-10-32(11-9-29)34-18-21-37(48-40(44)28(4)25-45-5)36(23-34)33-14-12-30(13-15-33)31-16-19-35(20-17-31)47-39(43)27(3)24-41/h8-11,18,21,23,28,30-31,33,35,41H,1,3,6-7,12-17,19-20,22,24-25H2,2,4-5H3 |
| InChIKey | BWZLRXBBJBFDHP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.85 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|