C39H50O7 — CID 146668872
[4-[3-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]cyclohexyl]cyclohexyl]-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 146668872) has the molecular formula C39H50O7 and a molecular weight of 630.82 g/mol. Its IUPAC name is [4-[3-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]cyclohexyl]cyclohexyl]-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]cyclohexyl]cyclohexyl]-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146668872 |
| Molecular Formula | C39H50O7 |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.36 |
| IUPAC Name | [4-[3-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]cyclohexyl]cyclohexyl]-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(=O)C(C)(C)C)cc2)cc1C1CCC(C2CCC(CCOC(=O)C(=C)CO)CC2)CC1 |
| InChI | InChI=1S/C39H50O7/c1-25(2)36(41)46-35-20-17-32(30-15-18-33(19-16-30)45-38(43)39(4,5)6)23-34(35)31-13-11-29(12-14-31)28-9-7-27(8-10-28)21-22-44-37(42)26(3)24-40/h15-20,23,27-29,31,40H,1,3,7-14,21-22,24H2,2,4-6H3 |
| InChIKey | YTTHQZUDJQAFFX-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|