C28H40O6 — CID 134246571
[2-(2-methylprop-2-enoyloxymethyl)-3-[4-(6-pentyloxan-3-yl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246571) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxymethyl)-3-[4-(6-pentyloxan-3-yl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-(2-methylprop-2-enoyloxymethyl)-3-[4-(6-pentyloxan-3-yl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246571 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxymethyl)-3-[4-(6-pentyloxan-3-yl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)CO)Cc1ccc(C2CCC(CCCCC)OC2)cc1 |
| InChI | InChI=1S/C28H40O6/c1-5-6-7-8-26-14-13-25(19-32-26)24-11-9-22(10-12-24)15-23(17-33-27(30)20(2)3)18-34-28(31)21(4)16-29/h9-12,23,25-26,29H,2,4-8,13-19H2,1,3H3 |
| InChIKey | MPWUAZNDRGYEQY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|