C30H38O6 — CID 138529453
[3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-methyl-2-[4-(3-methyl-4-pentylphenyl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138529453) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-methyl-2-[4-(3-methyl-4-pentylphenyl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-methyl-2-[4-(3-methyl-4-pentylphenyl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138529453 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-methyl-2-[4-(3-methyl-4-pentylphenyl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(C)(COC(=O)C(=C)CO)c1ccc(-c2ccc(CCCCC)c(C)c2)cc1 |
| InChI | InChI=1S/C30H38O6/c1-6-7-8-9-24-10-11-26(16-21(24)2)25-12-14-27(15-13-25)30(5,19-35-28(33)22(3)17-31)20-36-29(34)23(4)18-32/h10-16,31-32H,3-4,6-9,17-20H2,1-2,5H3 |
| InChIKey | OATGXVOQSGVFNW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|