C39H49NO5 — CID 146725078
[2-(2-methylprop-2-enoyloxymethyl)-4-[4-[4-[2-(5-pentyl-2-pyridinyl)ethyl]phenyl]phenyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate (PubChem CID 146725078) has the molecular formula C39H49NO5 and a molecular weight of 611.82 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[4-[2-(5-pentyl-2-pyridinyl)ethyl]phenyl]phenyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate.
| Compound Name | [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[4-[2-(5-pentyl-2-pyridinyl)ethyl]phenyl]phenyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 146725078 |
| Molecular Formula | C39H49NO5 |
| Molecular Weight | 611.82 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[4-[2-(5-pentyl-2-pyridinyl)ethyl]phenyl]phenyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C)C(=O)OCC(CCc1ccc(-c2ccc(CCc3ccc(CCCCC)cn3)cc2)cc1)COC(=O)C(=C)C(C)(C)O |
| InChI | InChI=1S/C39H49NO5/c1-7-8-9-10-32-18-24-36(40-25-32)23-17-31-15-21-35(22-16-31)34-19-13-30(14-20-34)11-12-33(26-44-37(41)28(2)3)27-45-38(42)29(4)39(5,6)43/h13-16,18-22,24-25,33,43H,2,4,7-12,17,23,26-27H2,1,3,5-6H3 |
| InChIKey | RGFAEPXNKDBRKM-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.82 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|