C37H54O7 — CID 166645885
[2-[[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]methyl]-6-[6-[2-(6-pentylnaphthalen-2-yl)ethyl]oxan-3-yl]hexyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 166645885) has the molecular formula C37H54O7 and a molecular weight of 610.83 g/mol. Its IUPAC name is [2-[[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]methyl]-6-[6-[2-(6-pentylnaphthalen-2-yl)ethyl]oxan-3-yl]hexyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]methyl]-6-[6-[2-(6-pentylnaphthalen-2-yl)ethyl]oxan-3-yl]hexyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 166645885 |
| Molecular Formula | C37H54O7 |
| Molecular Weight | 610.83 g/mol |
| Exact Mass | 610.39 |
| IUPAC Name | [2-[[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]methyl]-6-[6-[2-(6-pentylnaphthalen-2-yl)ethyl]oxan-3-yl]hexyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCCCC1CCC(CCc2ccc3cc(CCCCC)ccc3c2)OC1)COC(O)C(=C)CO |
| InChI | InChI=1S/C37H54O7/c1-4-5-6-9-29-12-16-34-21-30(13-17-33(34)20-29)14-18-35-19-15-31(24-42-35)10-7-8-11-32(25-43-36(40)27(2)22-38)26-44-37(41)28(3)23-39/h12-13,16-17,20-21,31-32,35-36,38-40H,2-11,14-15,18-19,22-26H2,1H3 |
| InChIKey | JUAMGLHZRSEFIB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.83 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|