C35H54O4 — CID 138529157
[2-(methoxymethyl)-6-[5-[3-[3-[(Z)-3-methylideneoct-1-enyl]phenyl]propyl]oxan-2-yl]hexyl] 2-methylprop-2-enoate (PubChem CID 138529157) has the molecular formula C35H54O4 and a molecular weight of 538.81 g/mol. Its IUPAC name is [2-(methoxymethyl)-6-[5-[3-[3-[(Z)-3-methylideneoct-1-enyl]phenyl]propyl]oxan-2-yl]hexyl] 2-methylprop-2-enoate.
| Compound Name | [2-(methoxymethyl)-6-[5-[3-[3-[(Z)-3-methylideneoct-1-enyl]phenyl]propyl]oxan-2-yl]hexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138529157 |
| Molecular Formula | C35H54O4 |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.40 |
| IUPAC Name | [2-(methoxymethyl)-6-[5-[3-[3-[(Z)-3-methylideneoct-1-enyl]phenyl]propyl]oxan-2-yl]hexyl] 2-methylprop-2-enoate |
| SMILES | C=C(/C=C\c1cccc(CCCC2CCC(CCCCC(COC)COC(=O)C(=C)C)OC2)c1)CCCCC |
| InChI | InChI=1S/C35H54O4/c1-6-7-8-13-29(4)20-21-31-17-11-15-30(24-31)16-12-18-32-22-23-34(38-26-32)19-10-9-14-33(25-37-5)27-39-35(36)28(2)3/h11,15,17,20-21,24,32-34H,2,4,6-10,12-14,16,18-19,22-23,25-27H2,1,3,5H3/b21-20- |
| InChIKey | DTWPPQHAZGRNOW-MRCUWXFGSA-N |
| XLogP | 8.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|