C37H53FO5 — CID 145411953
[6-[4-[2-[6-(4-fluorobutyl)naphthalen-2-yl]ethyl]cyclohexyl]-2-(hydroxymethyl)hexyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal (PubChem CID 145411953) has the molecular formula C37H53FO5 and a molecular weight of 596.82 g/mol. Its IUPAC name is [6-[4-[2-[6-(4-fluorobutyl)naphthalen-2-yl]ethyl]cyclohexyl]-2-(hydroxymethyl)hexyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal.
| Compound Name | [6-[4-[2-[6-(4-fluorobutyl)naphthalen-2-yl]ethyl]cyclohexyl]-2-(hydroxymethyl)hexyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal |
|---|---|
| PubChem CID | 145411953 |
| Molecular Formula | C37H53FO5 |
| Molecular Weight | 596.82 g/mol |
| Exact Mass | 596.39 |
| IUPAC Name | [6-[4-[2-[6-(4-fluorobutyl)naphthalen-2-yl]ethyl]cyclohexyl]-2-(hydroxymethyl)hexyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal |
| SMILES | C=C(C)C(=O)OCC(CO)CCCCC1CCC(CCc2ccc3cc(CCCCF)ccc3c2)CC1.C=C(C=O)CO |
| InChI | InChI=1S/C33H47FO3.C4H6O2/c1-25(2)33(36)37-24-30(23-35)9-4-3-7-26-10-12-27(13-11-26)14-15-29-17-19-31-21-28(8-5-6-20-34)16-18-32(31)22-29;1-4(2-5)3-6/h16-19,21-22,26-27,30,35H,1,3-15,20,23-24H2,2H3;2,6H,1,3H2 |
| InChIKey | HMRNCSHVZOIKAN-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.82 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|