C33H54O5 — CID 142281998
4-[3-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-(methoxymethyl)butan-1-ol;2-(hydroxymethyl)prop-2-enal;2-methylprop-2-enal (PubChem CID 142281998) has the molecular formula C33H54O5 and a molecular weight of 530.79 g/mol. Its IUPAC name is 4-[3-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-(methoxymethyl)butan-1-ol;2-(hydroxymethyl)prop-2-enal;2-methylprop-2-enal.
| Compound Name | 4-[3-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-(methoxymethyl)butan-1-ol;2-(hydroxymethyl)prop-2-enal;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142281998 |
| Molecular Formula | C33H54O5 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | 4-[3-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-(methoxymethyl)butan-1-ol;2-(hydroxymethyl)prop-2-enal;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.C=C(C=O)CO.CCCCCC1CCC(c2ccc(CCC(CO)COC)cc2CC)CC1 |
| InChI | InChI=1S/C25H42O2.C4H6O2.C4H6O/c1-4-6-7-8-20-11-14-24(15-12-20)25-16-13-21(17-23(25)5-2)9-10-22(18-26)19-27-3;1-4(2-5)3-6;1-4(2)3-5/h13,16-17,20,22,24,26H,4-12,14-15,18-19H2,1-3H3;2,6H,1,3H2;3H,1H2,2H3 |
| InChIKey | ZICFTDPWYVOHFJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|