C29H46O4 — CID 145411512
[2-(methoxymethyl)-2-[4-(4-pentylphenyl)cyclohexyl]hexyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411512) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is [2-(methoxymethyl)-2-[4-(4-pentylphenyl)cyclohexyl]hexyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-(methoxymethyl)-2-[4-(4-pentylphenyl)cyclohexyl]hexyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411512 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | [2-(methoxymethyl)-2-[4-(4-pentylphenyl)cyclohexyl]hexyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCCC)(COC)C1CCC(c2ccc(CCCCC)cc2)CC1 |
| InChI | InChI=1S/C29H46O4/c1-5-7-9-10-24-11-13-25(14-12-24)26-15-17-27(18-16-26)29(21-32-4,19-8-6-2)22-33-28(31)23(3)20-30/h11-14,26-27,30H,3,5-10,15-22H2,1-2,4H3 |
| InChIKey | ZDYPXCLBHJEGCY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|