C29H40O2 — CID 23334871
[4-[4-(2-methylbutyl)cyclohexyl]phenyl] 4-pentylbenzoate (PubChem CID 23334871) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is [4-[4-(2-methylbutyl)cyclohexyl]phenyl] 4-pentylbenzoate.
| Compound Name | [4-[4-(2-methylbutyl)cyclohexyl]phenyl] 4-pentylbenzoate |
|---|---|
| PubChem CID | 23334871 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | [4-[4-(2-methylbutyl)cyclohexyl]phenyl] 4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)Oc2ccc(C3CCC(CC(C)CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H40O2/c1-4-6-7-8-23-9-15-27(16-10-23)29(30)31-28-19-17-26(18-20-28)25-13-11-24(12-14-25)21-22(3)5-2/h9-10,15-20,22,24-25H,4-8,11-14,21H2,1-3H3 |
| InChIKey | FHWYTOJDZWKZIY-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|