C29H38O5 — CID 70372481
(2R)-2-[4-[4-(4-heptylcyclohexyl)benzoyl]oxyphenoxy]propanoic acid (PubChem CID 70372481) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is (2R)-2-[4-[4-(4-heptylcyclohexyl)benzoyl]oxyphenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[4-(4-heptylcyclohexyl)benzoyl]oxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 70372481 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (2R)-2-[4-[4-(4-heptylcyclohexyl)benzoyl]oxyphenoxy]propanoic acid |
| SMILES | CCCCCCCC1CCC(c2ccc(C(=O)Oc3ccc(O[C@H](C)C(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H38O5/c1-3-4-5-6-7-8-22-9-11-23(12-10-22)24-13-15-25(16-14-24)29(32)34-27-19-17-26(18-20-27)33-21(2)28(30)31/h13-23H,3-12H2,1-2H3,(H,30,31)/t21-,22?,23?/m1/s1 |
| InChIKey | XMMDCXPLYPFHRU-DDRJZQQSSA-N |
| XLogP | 7.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|