C38H46O5 — CID 3104664
4-O-(4-heptylphenyl) 1-O-[2-oxo-2-[4-(4-propylcyclohexyl)phenyl]ethyl] benzene-1,4-dicarboxylate (PubChem CID 3104664) has the molecular formula C38H46O5 and a molecular weight of 582.78 g/mol. Its IUPAC name is 4-O-(4-heptylphenyl) 1-O-[2-oxo-2-[4-(4-propylcyclohexyl)phenyl]ethyl] benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(4-heptylphenyl) 1-O-[2-oxo-2-[4-(4-propylcyclohexyl)phenyl]ethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 3104664 |
| Molecular Formula | C38H46O5 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | 4-O-(4-heptylphenyl) 1-O-[2-oxo-2-[4-(4-propylcyclohexyl)phenyl]ethyl] benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCc1ccc(OC(=O)c2ccc(C(=O)OCC(=O)c3ccc(C4CCC(CCC)CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H46O5/c1-3-5-6-7-8-10-29-13-25-35(26-14-29)43-38(41)34-23-21-33(22-24-34)37(40)42-27-36(39)32-19-17-31(18-20-32)30-15-11-28(9-4-2)12-16-30/h13-14,17-26,28,30H,3-12,15-16,27H2,1-2H3 |
| InChIKey | UCUKCRLUEIEHMM-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|