C40H62O6 — CID 134244441
[2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]-4-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134244441) has the molecular formula C40H62O6 and a molecular weight of 638.93 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]-4-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]-4-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134244441 |
| Molecular Formula | C40H62O6 |
| Molecular Weight | 638.93 g/mol |
| Exact Mass | 638.45 |
| IUPAC Name | [2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]-4-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCC1CCC(C2CCC(C3CCC4C=C(CCCCC)C=CC4C3)CC2)CC1)COC(=O)C(=C)CO |
| InChI | InChI=1S/C40H62O6/c1-4-5-6-7-31-12-15-38-23-37(21-20-36(38)22-31)35-18-16-34(17-19-35)33-13-10-30(11-14-33)8-9-32(26-45-39(43)28(2)24-41)27-46-40(44)29(3)25-42/h12,15,22,30,32-38,41-42H,2-11,13-14,16-21,23-27H2,1H3 |
| InChIKey | VDNMMNPEANKMJT-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.93 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|