C36H60O3 — CID 166645837
2-[(1-hydroxy-2-methylprop-2-enoxy)methyl]-4-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]butan-1-ol (PubChem CID 166645837) has the molecular formula C36H60O3 and a molecular weight of 540.87 g/mol. Its IUPAC name is 2-[(1-hydroxy-2-methylprop-2-enoxy)methyl]-4-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]butan-1-ol.
| Compound Name | 2-[(1-hydroxy-2-methylprop-2-enoxy)methyl]-4-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]butan-1-ol |
|---|---|
| PubChem CID | 166645837 |
| Molecular Formula | C36H60O3 |
| Molecular Weight | 540.87 g/mol |
| Exact Mass | 540.45 |
| IUPAC Name | 2-[(1-hydroxy-2-methylprop-2-enoxy)methyl]-4-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]butan-1-ol |
| SMILES | C=C(C)C(O)OCC(CO)CCC1CCC(C2CCC(C3CCC4C=C(CCCCC)C=CC4C3)CC2)CC1 |
| InChI | InChI=1S/C36H60O3/c1-4-5-6-7-28-12-15-35-23-34(21-20-33(35)22-28)32-18-16-31(17-19-32)30-13-10-27(11-14-30)8-9-29(24-37)25-39-36(38)26(2)3/h12,15,22,27,29-38H,2,4-11,13-14,16-21,23-25H2,1,3H3 |
| InChIKey | AZOMIDRUYMEVFV-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.87 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|