C40H66O6 — CID 142281626
bis(2-(hydroxymethyl)prop-2-enal);2-[2-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]ethyl]propane-1,3-diol (PubChem CID 142281626) has the molecular formula C40H66O6 and a molecular weight of 642.96 g/mol. Its IUPAC name is bis(2-(hydroxymethyl)prop-2-enal);2-[2-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]ethyl]propane-1,3-diol.
| Compound Name | bis(2-(hydroxymethyl)prop-2-enal);2-[2-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 142281626 |
| Molecular Formula | C40H66O6 |
| Molecular Weight | 642.96 g/mol |
| Exact Mass | 642.49 |
| IUPAC Name | bis(2-(hydroxymethyl)prop-2-enal);2-[2-[4-[4-(6-pentyl-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl)cyclohexyl]cyclohexyl]ethyl]propane-1,3-diol |
| SMILES | C=C(C=O)CO.C=C(C=O)CO.CCCCCC1=CC2CCC(C3CCC(C4CCC(CCC(CO)CO)CC4)CC3)CC2C=C1 |
| InChI | InChI=1S/C32H54O2.2C4H6O2/c1-2-3-4-5-25-10-13-32-21-31(19-18-30(32)20-25)29-16-14-28(15-17-29)27-11-8-24(9-12-27)6-7-26(22-33)23-34;2*1-4(2-5)3-6/h10,13,20,24,26-34H,2-9,11-12,14-19,21-23H2,1H3;2*2,6H,1,3H2 |
| InChIKey | JHOSKKOEPWQVPN-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.96 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|