C33H50O6 — CID 134244376
[3-[1-hydroxy-2-(oxan-2-yloxymethyl)prop-2-enoxy]-2-[4-(4-pentylphenyl)cyclohexyl]propyl] 2-methylprop-2-enoate (PubChem CID 134244376) has the molecular formula C33H50O6 and a molecular weight of 542.76 g/mol. Its IUPAC name is [3-[1-hydroxy-2-(oxan-2-yloxymethyl)prop-2-enoxy]-2-[4-(4-pentylphenyl)cyclohexyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3-[1-hydroxy-2-(oxan-2-yloxymethyl)prop-2-enoxy]-2-[4-(4-pentylphenyl)cyclohexyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134244376 |
| Molecular Formula | C33H50O6 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | [3-[1-hydroxy-2-(oxan-2-yloxymethyl)prop-2-enoxy]-2-[4-(4-pentylphenyl)cyclohexyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(O)C(=C)COC1CCCCO1)C1CCC(c2ccc(CCCCC)cc2)CC1 |
| InChI | InChI=1S/C33H50O6/c1-5-6-7-10-26-12-14-27(15-13-26)28-16-18-29(19-17-28)30(22-38-32(34)24(2)3)23-39-33(35)25(4)21-37-31-11-8-9-20-36-31/h12-15,28-31,33,35H,2,4-11,16-23H2,1,3H3 |
| InChIKey | RPJJJZUAQSBGAO-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|