C14H28N2O2 — CID 176675584
(E)-2-N-ethyl-2-N-(2-methoxyethyl)-1-N,1-N-dimethylprop-1-ene-1,2-diamine;2-methylprop-2-enal (PubChem CID 176675584) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (E)-2-N-ethyl-2-N-(2-methoxyethyl)-1-N,1-N-dimethylprop-1-ene-1,2-diamine;2-methylprop-2-enal.
| Compound Name | (E)-2-N-ethyl-2-N-(2-methoxyethyl)-1-N,1-N-dimethylprop-1-ene-1,2-diamine;2-methylprop-2-enal |
|---|---|
| PubChem CID | 176675584 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | (E)-2-N-ethyl-2-N-(2-methoxyethyl)-1-N,1-N-dimethylprop-1-ene-1,2-diamine;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CCN(CCOC)/C(C)=C/N(C)C |
| InChI | InChI=1S/C10H22N2O.C4H6O/c1-6-12(7-8-13-5)10(2)9-11(3)4;1-4(2)3-5/h9H,6-8H2,1-5H3;3H,1H2,2H3/b10-9+; |
| InChIKey | FAAZGDAWMPOUJV-RRABGKBLSA-N |
| XLogP | 2.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|