C8H18N2O2 — CID 115590966
1-ethyl-1-(2-methoxyethyl)-3,3-dimethylurea (PubChem CID 115590966) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-ethyl-1-(2-methoxyethyl)-3,3-dimethylurea.
| Compound Name | 1-ethyl-1-(2-methoxyethyl)-3,3-dimethylurea |
|---|---|
| PubChem CID | 115590966 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-ethyl-1-(2-methoxyethyl)-3,3-dimethylurea |
| SMILES | CCN(CCOC)C(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O2/c1-5-10(6-7-12-4)8(11)9(2)3/h5-7H2,1-4H3 |
| InChIKey | FOICJTRDFNXCRY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |