About N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide
N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide (PubChem CID 144955256) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide |
|---|
| PubChem CID | 144955256 |
|---|
| Molecular Formula | C8H18N2O |
|---|
| Molecular Weight | 158.24 g/mol |
|---|
| Exact Mass | 158.14 |
|---|
| IUPAC Name | N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide |
|---|
| SMILES | CCN(CCOC)/C(C)=N/C |
|---|
| InChI | InChI=1S/C8H18N2O/c1-5-10(6-7-11-4)8(2)9-3/h5-7H2,1-4H3/b9-8+ |
|---|
| InChIKey | ULRPEKHGIOULEQ-CMDGGOBGSA-N |
|---|
| XLogP | 1.00 |
|---|
| TPSA | 24.83 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 4 |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide?
The IUPAC name of N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide (CID 144955256) is N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide.
What is the SMILES notation for N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide?
The canonical SMILES for N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide is CCN(CCOC)/C(C)=N/C.
What is the InChIKey of N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide?
The InChIKey is ULRPEKHGIOULEQ-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H18N2O/c1-5-10(6-7-11-4)8(2)9-3/h5-7H2,1-4H3/b9-8+.
What are the key properties of N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide?
N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide has a molecular weight of 158.24 g/mol, XLogP of 1.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(2-methoxyethyl)-N'-methylethanimidamide is sourced from PubChem (CID 144955256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).