About N'-methyl-N,N-dioctylethanimidamide
N'-methyl-N,N-dioctylethanimidamide (PubChem CID 139776671) has the molecular formula C19H40N2
and a molecular weight of 296.54 g/mol. Its IUPAC name is N'-methyl-N,N-dioctylethanimidamide.
Molecular Properties
| Compound Name | N'-methyl-N,N-dioctylethanimidamide |
| PubChem CID | 139776671 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | N'-methyl-N,N-dioctylethanimidamide |
| SMILES | CCCCCCCCN(CCCCCCCC)/C(C)=N/C |
| InChI | InChI=1S/C19H40N2/c1-5-7-9-11-13-15-17-21(19(3)20-4)18-16-14-12-10-8-6-2/h5-18H2,1-4H3/b20-19+ |
| InChIKey | DGZCAYYZLLANAK-FMQUCBEESA-N |
| XLogP | 6.06 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N,N-dioctylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N,N-dioctylethanimidamide?
The IUPAC name of N'-methyl-N,N-dioctylethanimidamide (CID 139776671) is N'-methyl-N,N-dioctylethanimidamide.
What is the SMILES notation for N'-methyl-N,N-dioctylethanimidamide?
The canonical SMILES for N'-methyl-N,N-dioctylethanimidamide is CCCCCCCCN(CCCCCCCC)/C(C)=N/C.
What is the InChIKey of N'-methyl-N,N-dioctylethanimidamide?
The InChIKey is DGZCAYYZLLANAK-FMQUCBEESA-N. The full InChI is InChI=1S/C19H40N2/c1-5-7-9-11-13-15-17-21(19(3)20-4)18-16-14-12-10-8-6-2/h5-18H2,1-4H3/b20-19+.
What are the key properties of N'-methyl-N,N-dioctylethanimidamide?
N'-methyl-N,N-dioctylethanimidamide has a molecular weight of 296.54 g/mol, XLogP of 6.06, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N,N-dioctylethanimidamide is sourced from PubChem (CID 139776671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).