About but-2-enoic acid;2-methoxyethanamine
but-2-enoic acid;2-methoxyethanamine (PubChem CID 173271509) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is but-2-enoic acid;2-methoxyethanamine.
Molecular Properties
| Compound Name | but-2-enoic acid;2-methoxyethanamine |
| PubChem CID | 173271509 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | but-2-enoic acid;2-methoxyethanamine |
| SMILES | CC=CC(=O)O.COCCN |
| InChI | InChI=1S/C4H6O2.C3H9NO/c1-2-3-4(5)6;1-5-3-2-4/h2-3H,1H3,(H,5,6);2-4H2,1H3 |
| InChIKey | AVWIQTXWMQZKCQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enoic acid;2-methoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enoic acid;2-methoxyethanamine?
The IUPAC name of but-2-enoic acid;2-methoxyethanamine (CID 173271509) is but-2-enoic acid;2-methoxyethanamine.
What is the SMILES notation for but-2-enoic acid;2-methoxyethanamine?
The canonical SMILES for but-2-enoic acid;2-methoxyethanamine is CC=CC(=O)O.COCCN.
What is the InChIKey of but-2-enoic acid;2-methoxyethanamine?
The InChIKey is AVWIQTXWMQZKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H9NO/c1-2-3-4(5)6;1-5-3-2-4/h2-3H,1H3,(H,5,6);2-4H2,1H3.
What are the key properties of but-2-enoic acid;2-methoxyethanamine?
but-2-enoic acid;2-methoxyethanamine has a molecular weight of 161.20 g/mol, XLogP of 0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enoic acid;2-methoxyethanamine is sourced from PubChem (CID 173271509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).