About but-2-enoic acid;formic acid
but-2-enoic acid;formic acid (PubChem CID 53399155) has the molecular formula C5H8O4
and a molecular weight of 132.11 g/mol. Its IUPAC name is but-2-enoic acid;formic acid.
Molecular Properties
| Compound Name | but-2-enoic acid;formic acid |
| PubChem CID | 53399155 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | but-2-enoic acid;formic acid |
| SMILES | CC=CC(=O)O.O=CO |
| InChI | InChI=1S/C4H6O2.CH2O2/c1-2-3-4(5)6;2-1-3/h2-3H,1H3,(H,5,6);1H,(H,2,3) |
| InChIKey | QLVHOWOIOBVGPO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enoic acid;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enoic acid;formic acid?
The IUPAC name of but-2-enoic acid;formic acid (CID 53399155) is but-2-enoic acid;formic acid.
What is the SMILES notation for but-2-enoic acid;formic acid?
The canonical SMILES for but-2-enoic acid;formic acid is CC=CC(=O)O.O=CO.
What is the InChIKey of but-2-enoic acid;formic acid?
The InChIKey is QLVHOWOIOBVGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.CH2O2/c1-2-3-4(5)6;2-1-3/h2-3H,1H3,(H,5,6);1H,(H,2,3).
What are the key properties of but-2-enoic acid;formic acid?
but-2-enoic acid;formic acid has a molecular weight of 132.11 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enoic acid;formic acid is sourced from PubChem (CID 53399155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).