4-oxohepta-2,5-dienoic acid

C7H8O3 — CID 54093333

IUPAC4-oxohepta-2,5-dienoic acid
SMILESCC=CC(=O)C=CC(=O)O
InChIInChI=1S/C7H8O3/c1-2-3-6(8)4-5-7(9)10/h2-5H,1H3,(H,9,10)
InChIKeyMVKBUMZBWASNSB-UHFFFAOYSA-N
MW140.14 g/mol
LogP0.77
Rot. Bonds3

About 4-oxohepta-2,5-dienoic acid

4-oxohepta-2,5-dienoic acid (PubChem CID 54093333) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is 4-oxohepta-2,5-dienoic acid.

Molecular Properties

Compound Name4-oxohepta-2,5-dienoic acid
PubChem CID54093333
Molecular FormulaC7H8O3
Molecular Weight140.14 g/mol
Exact Mass140.05
IUPAC Name4-oxohepta-2,5-dienoic acid
SMILESCC=CC(=O)C=CC(=O)O
InChIInChI=1S/C7H8O3/c1-2-3-6(8)4-5-7(9)10/h2-5H,1H3,(H,9,10)
InChIKeyMVKBUMZBWASNSB-UHFFFAOYSA-N
XLogP0.77
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.14
LogP ≤ 50.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-oxohepta-2,5-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxohepta-2,5-dienoic acid?
The IUPAC name of 4-oxohepta-2,5-dienoic acid (CID 54093333) is 4-oxohepta-2,5-dienoic acid.
What is the SMILES notation for 4-oxohepta-2,5-dienoic acid?
The canonical SMILES for 4-oxohepta-2,5-dienoic acid is CC=CC(=O)C=CC(=O)O.
What is the InChIKey of 4-oxohepta-2,5-dienoic acid?
The InChIKey is MVKBUMZBWASNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-2-3-6(8)4-5-7(9)10/h2-5H,1H3,(H,9,10).
What are the key properties of 4-oxohepta-2,5-dienoic acid?
4-oxohepta-2,5-dienoic acid has a molecular weight of 140.14 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohepta-2,5-dienoic acid is sourced from PubChem (CID 54093333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).