About but-2-enoic acid;phosphane;hydrate
but-2-enoic acid;phosphane;hydrate (PubChem CID 161337391) has the molecular formula C4H11O3P
and a molecular weight of 138.10 g/mol. Its IUPAC name is but-2-enoic acid;phosphane;hydrate.
Molecular Properties
| Compound Name | but-2-enoic acid;phosphane;hydrate |
| PubChem CID | 161337391 |
| Molecular Formula | C4H11O3P |
| Molecular Weight | 138.10 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | but-2-enoic acid;phosphane;hydrate |
| SMILES | CC=CC(=O)O.O.P |
| InChI | InChI=1S/C4H6O2.H2O.H3P/c1-2-3-4(5)6;;/h2-3H,1H3,(H,5,6);1H2;1H3 |
| InChIKey | BIQAWFFJUBFCJV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.10 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze but-2-enoic acid;phosphane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enoic acid;phosphane;hydrate?
The IUPAC name of but-2-enoic acid;phosphane;hydrate (CID 161337391) is but-2-enoic acid;phosphane;hydrate.
What is the SMILES notation for but-2-enoic acid;phosphane;hydrate?
The canonical SMILES for but-2-enoic acid;phosphane;hydrate is CC=CC(=O)O.O.P.
What is the InChIKey of but-2-enoic acid;phosphane;hydrate?
The InChIKey is BIQAWFFJUBFCJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.H2O.H3P/c1-2-3-4(5)6;;/h2-3H,1H3,(H,5,6);1H2;1H3.
What are the key properties of but-2-enoic acid;phosphane;hydrate?
but-2-enoic acid;phosphane;hydrate has a molecular weight of 138.10 g/mol, XLogP of -0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enoic acid;phosphane;hydrate is sourced from PubChem (CID 161337391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).