About but-2-enoic acid;N-methylmethanamine;hydrochloride
but-2-enoic acid;N-methylmethanamine;hydrochloride (PubChem CID 173091669) has the molecular formula C6H14ClNO2
and a molecular weight of 167.64 g/mol. Its IUPAC name is but-2-enoic acid;N-methylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | but-2-enoic acid;N-methylmethanamine;hydrochloride |
| PubChem CID | 173091669 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | but-2-enoic acid;N-methylmethanamine;hydrochloride |
| SMILES | CC=CC(=O)O.CNC.Cl |
| InChI | InChI=1S/C4H6O2.C2H7N.ClH/c1-2-3-4(5)6;1-3-2;/h2-3H,1H3,(H,5,6);3H,1-2H3;1H |
| InChIKey | CNGHLOIDOLKQSD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enoic acid;N-methylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enoic acid;N-methylmethanamine;hydrochloride?
The IUPAC name of but-2-enoic acid;N-methylmethanamine;hydrochloride (CID 173091669) is but-2-enoic acid;N-methylmethanamine;hydrochloride.
What is the SMILES notation for but-2-enoic acid;N-methylmethanamine;hydrochloride?
The canonical SMILES for but-2-enoic acid;N-methylmethanamine;hydrochloride is CC=CC(=O)O.CNC.Cl.
What is the InChIKey of but-2-enoic acid;N-methylmethanamine;hydrochloride?
The InChIKey is CNGHLOIDOLKQSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2H7N.ClH/c1-2-3-4(5)6;1-3-2;/h2-3H,1H3,(H,5,6);3H,1-2H3;1H.
What are the key properties of but-2-enoic acid;N-methylmethanamine;hydrochloride?
but-2-enoic acid;N-methylmethanamine;hydrochloride has a molecular weight of 167.64 g/mol, XLogP of 0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enoic acid;N-methylmethanamine;hydrochloride is sourced from PubChem (CID 173091669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).