About but-2-enoic acid;2-tert-butylperoxy-2-methylpropane
but-2-enoic acid;2-tert-butylperoxy-2-methylpropane (PubChem CID 162086796) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is but-2-enoic acid;2-tert-butylperoxy-2-methylpropane.
Molecular Properties
| Compound Name | but-2-enoic acid;2-tert-butylperoxy-2-methylpropane |
| PubChem CID | 162086796 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | but-2-enoic acid;2-tert-butylperoxy-2-methylpropane |
| SMILES | CC(C)(C)OOC(C)(C)C.CC=CC(=O)O |
| InChI | InChI=1S/C8H18O2.C4H6O2/c1-7(2,3)9-10-8(4,5)6;1-2-3-4(5)6/h1-6H3;2-3H,1H3,(H,5,6) |
| InChIKey | ZDBNULRMNNNPCR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze but-2-enoic acid;2-tert-butylperoxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enoic acid;2-tert-butylperoxy-2-methylpropane?
The IUPAC name of but-2-enoic acid;2-tert-butylperoxy-2-methylpropane (CID 162086796) is but-2-enoic acid;2-tert-butylperoxy-2-methylpropane.
What is the SMILES notation for but-2-enoic acid;2-tert-butylperoxy-2-methylpropane?
The canonical SMILES for but-2-enoic acid;2-tert-butylperoxy-2-methylpropane is CC(C)(C)OOC(C)(C)C.CC=CC(=O)O.
What is the InChIKey of but-2-enoic acid;2-tert-butylperoxy-2-methylpropane?
The InChIKey is ZDBNULRMNNNPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.C4H6O2/c1-7(2,3)9-10-8(4,5)6;1-2-3-4(5)6/h1-6H3;2-3H,1H3,(H,5,6).
What are the key properties of but-2-enoic acid;2-tert-butylperoxy-2-methylpropane?
but-2-enoic acid;2-tert-butylperoxy-2-methylpropane has a molecular weight of 232.32 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enoic acid;2-tert-butylperoxy-2-methylpropane is sourced from PubChem (CID 162086796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).