C17H24O — CID 145122159
(3E,7Z)-4-(methoxymethyl)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene (PubChem CID 145122159) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (3E,7Z)-4-(methoxymethyl)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene.
| Compound Name | (3E,7Z)-4-(methoxymethyl)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene |
|---|---|
| PubChem CID | 145122159 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (3E,7Z)-4-(methoxymethyl)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene |
| SMILES | C=C(C)/C=C(/COC)C(=C)C(=C)/C=C\C(=C)CC |
| InChI | InChI=1S/C17H24O/c1-8-14(4)9-10-15(5)16(6)17(12-18-7)11-13(2)3/h9-11H,2,4-6,8,12H2,1,3,7H3/b10-9-,17-11- |
| InChIKey | KQXATJWNNPPFHQ-XJPAVUHSSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|