C13H24O — CID 142994407
ethane;(Z)-1-methoxy-3,6-dimethylideneoct-4-ene (PubChem CID 142994407) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is ethane;(Z)-1-methoxy-3,6-dimethylideneoct-4-ene.
| Compound Name | ethane;(Z)-1-methoxy-3,6-dimethylideneoct-4-ene |
|---|---|
| PubChem CID | 142994407 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | ethane;(Z)-1-methoxy-3,6-dimethylideneoct-4-ene |
| SMILES | C=C(/C=C\C(=C)CCOC)CC.CC |
| InChI | InChI=1S/C11H18O.C2H6/c1-5-10(2)6-7-11(3)8-9-12-4;1-2/h6-7H,2-3,5,8-9H2,1,4H3;1-2H3/b7-6-; |
| InChIKey | GMEPDJNNGVPYFO-NAFXZHHSSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|