C12H22 — CID 143257359
ethane;(3Z)-2-methyl-5-methylideneocta-1,3-diene (PubChem CID 143257359) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is ethane;(3Z)-2-methyl-5-methylideneocta-1,3-diene.
| Compound Name | ethane;(3Z)-2-methyl-5-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 143257359 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | ethane;(3Z)-2-methyl-5-methylideneocta-1,3-diene |
| SMILES | C=C(C)/C=C\C(=C)CCC.CC |
| InChI | InChI=1S/C10H16.C2H6/c1-5-6-10(4)8-7-9(2)3;1-2/h7-8H,2,4-6H2,1,3H3;1-2H3/b8-7-; |
| InChIKey | JFBNKXWQTUUTLL-CFYXSCKTSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|