C15H32 — CID 144971150
(3Z)-2,5-dimethylhexa-1,3,5-triene;ethane;propane (PubChem CID 144971150) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is (3Z)-2,5-dimethylhexa-1,3,5-triene;ethane;propane.
| Compound Name | (3Z)-2,5-dimethylhexa-1,3,5-triene;ethane;propane |
|---|---|
| PubChem CID | 144971150 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | (3Z)-2,5-dimethylhexa-1,3,5-triene;ethane;propane |
| SMILES | C=C(C)/C=C\C(=C)C.CC.CC.CCC |
| InChI | InChI=1S/C8H12.C3H8.2C2H6/c1-7(2)5-6-8(3)4;1-3-2;2*1-2/h5-6H,1,3H2,2,4H3;3H2,1-2H3;2*1-2H3/b6-5-;;; |
| InChIKey | OAPSIPRJZJPINE-WTUPQPTJSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|