C13H24 — CID 142092985
ethane;(3Z,5Z)-2-methyl-5-propan-2-ylhepta-1,3,5-triene (PubChem CID 142092985) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is ethane;(3Z,5Z)-2-methyl-5-propan-2-ylhepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-2-methyl-5-propan-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142092985 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | ethane;(3Z,5Z)-2-methyl-5-propan-2-ylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C\C(=C/C)C(C)C.CC |
| InChI | InChI=1S/C11H18.C2H6/c1-6-11(10(4)5)8-7-9(2)3;1-2/h6-8,10H,2H2,1,3-5H3;1-2H3/b8-7-,11-6+; |
| InChIKey | GNBUGHGRADGGNV-WUYYFAKCSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|