C14H22 — CID 11106169
(3E,5S,6R,7E)-2,5,6,9-tetramethyldeca-1,3,7,9-tetraene (PubChem CID 11106169) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (3E,5S,6R,7E)-2,5,6,9-tetramethyldeca-1,3,7,9-tetraene.
| Compound Name | (3E,5S,6R,7E)-2,5,6,9-tetramethyldeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 11106169 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (3E,5S,6R,7E)-2,5,6,9-tetramethyldeca-1,3,7,9-tetraene |
| SMILES | C=C(C)/C=C/[C@@H](C)[C@@H](C)/C=C/C(=C)C |
| InChI | InChI=1S/C14H22/c1-11(2)7-9-13(5)14(6)10-8-12(3)4/h7-10,13-14H,1,3H2,2,4-6H3/b9-7+,10-8+/t13-,14+ |
| InChIKey | MVUFVUGDHNUBMH-CLAZGFPFSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|