C15H29N — CID 142206747
1-[(3Z)-5-methylhexa-3,5-dien-2-yl]piperidine;propane (PubChem CID 142206747) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 1-[(3Z)-5-methylhexa-3,5-dien-2-yl]piperidine;propane.
| Compound Name | 1-[(3Z)-5-methylhexa-3,5-dien-2-yl]piperidine;propane |
|---|---|
| PubChem CID | 142206747 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 1-[(3Z)-5-methylhexa-3,5-dien-2-yl]piperidine;propane |
| SMILES | C=C(C)/C=C\C(C)N1CCCCC1.CCC |
| InChI | InChI=1S/C12H21N.C3H8/c1-11(2)7-8-12(3)13-9-5-4-6-10-13;1-3-2/h7-8,12H,1,4-6,9-10H2,2-3H3;3H2,1-2H3/b8-7-; |
| InChIKey | ILHXHFXQHPDQTN-CFYXSCKTSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|